C16H23IN6O2S — CID 111140498
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111140498) has the molecular formula C16H23IN6O2S and a molecular weight of 490.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111140498 |
| Molecular Formula | C16H23IN6O2S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H22N6O2S.HI/c1-2-18-16(21-14-7-8-25(23,24)10-14)19-9-13-3-5-15(6-4-13)22-12-17-11-20-22;/h3-6,11-12,14H,2,7-10H2,1H3,(H2,18,19,21);1H |
| InChIKey | RUBIPKFLEAYQMQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|