C17H23ClIN5O2S — CID 111792319
2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111792319) has the molecular formula C17H23ClIN5O2S and a molecular weight of 523.83 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111792319 |
| Molecular Formula | C17H23ClIN5O2S |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccc(Cl)cc2)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H22ClN5O2S.HI/c1-2-19-17(22-15-7-8-26(24,25)12-15)20-9-13-10-21-23(11-13)16-5-3-14(18)4-6-16;/h3-6,10-11,15H,2,7-9,12H2,1H3,(H2,19,20,22);1H |
| InChIKey | HYNOBEKLBMSARJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|