C16H21ClIN5 — CID 111581060
2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111581060) has the molecular formula C16H21ClIN5 and a molecular weight of 445.74 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111581060 |
| Molecular Formula | C16H21ClIN5 |
| Molecular Weight | 445.74 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1cnn(-c2ccc(Cl)cc2)c1)NCC.I |
| InChI | InChI=1S/C16H20ClN5.HI/c1-3-9-19-16(18-4-2)20-10-13-11-21-22(12-13)15-7-5-14(17)6-8-15;/h3,5-8,11-12H,1,4,9-10H2,2H3,(H2,18,19,20);1H |
| InChIKey | JOIBAISCOQFWRU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|