C18H23ClIN7 — CID 111581082
2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111581082) has the molecular formula C18H23ClIN7 and a molecular weight of 499.79 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111581082 |
| Molecular Formula | C18H23ClIN7 |
| Molecular Weight | 499.79 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccc(Cl)cc2)c1)NCc1ccnn1C.I |
| InChI | InChI=1S/C18H22ClN7.HI/c1-3-20-18(22-12-17-8-9-23-25(17)2)21-10-14-11-24-26(13-14)16-6-4-15(19)5-7-16;/h4-9,11,13H,3,10,12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | MDKAFDFVEVYMQG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|