C15H21N5 — CID 75406975
1,3-diethyl-2-[(1-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 75406975) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 1,3-diethyl-2-[(1-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1,3-diethyl-2-[(1-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 75406975 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 1,3-diethyl-2-[(1-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCNC(=NCc1cnn(-c2ccccc2)c1)NCC |
| InChI | InChI=1S/C15H21N5/c1-3-16-15(17-4-2)18-10-13-11-19-20(12-13)14-8-6-5-7-9-14/h5-9,11-12H,3-4,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | FVRHGMXCDOZQIR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|