C20H27IN6S — CID 111531060
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111531060) has the molecular formula C20H27IN6S and a molecular weight of 510.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531060 |
| Molecular Formula | C20H27IN6S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccccc2)c1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C20H26N6S.HI/c1-3-18-14-23-19(27-18)10-11-22-20(21-4-2)24-12-16-13-25-26(15-16)17-8-6-5-7-9-17;/h5-9,13-15H,3-4,10-12H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | YHXFWZMRMHOWFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|