C23H29N5OS — CID 111531533
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine (PubChem CID 111531533) has the molecular formula C23H29N5OS and a molecular weight of 423.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111531533 |
| Molecular Formula | C23H29N5OS |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-phenylmethoxy-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OCc2ccccc2)c1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C23H29N5OS/c1-3-20-16-27-22(30-20)11-13-26-23(24-4-2)28-15-19-10-12-25-21(14-19)29-17-18-8-6-5-7-9-18/h5-10,12,14,16H,3-4,11,13,15,17H2,1-2H3,(H2,24,26,28) |
| InChIKey | CCAMWSFMXWQSLW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|