C21H34IN7S — CID 111532598
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111532598) has the molecular formula C21H34IN7S and a molecular weight of 543.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111532598 |
| Molecular Formula | C21H34IN7S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCN(C)CC2)c1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C21H33N7S.HI/c1-4-18-16-25-20(29-18)7-9-24-21(22-5-2)26-15-17-6-8-23-19(14-17)28-12-10-27(3)11-13-28;/h6,8,14,16H,4-5,7,9-13,15H2,1-3H3,(H2,22,24,26);1H |
| InChIKey | JYVQQWUKDHBKKM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|