C20H25N5S — CID 111897757
1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111897757) has the molecular formula C20H25N5S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111897757 |
| Molecular Formula | C20H25N5S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H25N5S/c1-3-21-20(23-14-19-10-9-16(2)26-19)22-12-11-17-13-24-25(15-17)18-7-5-4-6-8-18/h4-10,13,15H,3,11-12,14H2,1-2H3,(H2,21,22,23) |
| InChIKey | HOODABILTLWYJN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|