C19H25N7 — CID 111953431
1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine (PubChem CID 111953431) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111953431 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[2-(1-phenylpyrazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H25N7/c1-3-20-19(22-14-18-10-12-23-25(18)2)21-11-9-16-13-24-26(15-16)17-7-5-4-6-8-17/h4-8,10,12-13,15H,3,9,11,14H2,1-2H3,(H2,20,21,22) |
| InChIKey | FGEKCZSTPQVOPT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|