C20H24N6 — CID 111193892
1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111193892) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111193892 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-ethyl-2-[(1-phenylpyrazol-4-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccccc2)c1)NCCc1ccccn1 |
| InChI | InChI=1S/C20H24N6/c1-2-21-20(23-13-11-18-8-6-7-12-22-18)24-14-17-15-25-26(16-17)19-9-4-3-5-10-19/h3-10,12,15-16H,2,11,13-14H2,1H3,(H2,21,23,24) |
| InChIKey | JFADYQZSGITCBF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|