C17H26IN5O — CID 111237176
1-ethyl-3-(1-methoxypropan-2-yl)-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111237176) has the molecular formula C17H26IN5O and a molecular weight of 443.33 g/mol. Its IUPAC name is 1-ethyl-3-(1-methoxypropan-2-yl)-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(1-methoxypropan-2-yl)-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111237176 |
| Molecular Formula | C17H26IN5O |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-ethyl-3-(1-methoxypropan-2-yl)-2-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccccc2)c1)NC(C)COC.I |
| InChI | InChI=1S/C17H25N5O.HI/c1-4-18-17(21-14(2)13-23-3)19-10-15-11-20-22(12-15)16-8-6-5-7-9-16;/h5-9,11-12,14H,4,10,13H2,1-3H3,(H2,18,19,21);1H |
| InChIKey | JPQRFXSRLQXERF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|