C18H20ClN5O — CID 111581115
2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine (PubChem CID 111581115) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine.
| Compound Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111581115 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cnn(-c2ccc(Cl)cc2)c1)NCc1ccco1 |
| InChI | InChI=1S/C18H20ClN5O/c1-2-20-18(22-12-17-4-3-9-25-17)21-10-14-11-23-24(13-14)16-7-5-15(19)6-8-16/h3-9,11,13H,2,10,12H2,1H3,(H2,20,21,22) |
| InChIKey | JGAZJMPYQBXIBL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|