C13H19N3O3S — CID 94163988
1-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea (PubChem CID 94163988) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea.
| Compound Name | 1-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 94163988 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea |
| SMILES | C[C@H](NC(=O)NC[C@@H]1CCS(=O)(=O)C1)c1cccnc1 |
| InChI | InChI=1S/C13H19N3O3S/c1-10(12-3-2-5-14-8-12)16-13(17)15-7-11-4-6-20(18,19)9-11/h2-3,5,8,10-11H,4,6-7,9H2,1H3,(H2,15,16,17)/t10-,11-/m0/s1 |
| InChIKey | VQZSSDMHYGWQAL-QWRGUYRKSA-N |
| XLogP | 0.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |