C11H16N2O3S — CID 81403977
1,1-dioxo-4-[[(1S)-1-pyridin-3-ylethyl]amino]thiolan-3-ol (PubChem CID 81403977) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1,1-dioxo-4-[[(1S)-1-pyridin-3-ylethyl]amino]thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-[[(1S)-1-pyridin-3-ylethyl]amino]thiolan-3-ol |
|---|---|
| PubChem CID | 81403977 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1,1-dioxo-4-[[(1S)-1-pyridin-3-ylethyl]amino]thiolan-3-ol |
| SMILES | C[C@H](NC1CS(=O)(=O)CC1O)c1cccnc1 |
| InChI | InChI=1S/C11H16N2O3S/c1-8(9-3-2-4-12-5-9)13-10-6-17(15,16)7-11(10)14/h2-5,8,10-11,13-14H,6-7H2,1H3/t8-,10?,11?/m0/s1 |
| InChIKey | SANDZVRRDJZMCM-PUSIOWJLSA-N |
| XLogP | -0.11 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |