C12H18N2S — CID 102671440
2-methyl-N-(1-pyridin-3-ylethyl)thiolan-3-amine (PubChem CID 102671440) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 2-methyl-N-(1-pyridin-3-ylethyl)thiolan-3-amine.
| Compound Name | 2-methyl-N-(1-pyridin-3-ylethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 102671440 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-methyl-N-(1-pyridin-3-ylethyl)thiolan-3-amine |
| SMILES | CC(NC1CCSC1C)c1cccnc1 |
| InChI | InChI=1S/C12H18N2S/c1-9(11-4-3-6-13-8-11)14-12-5-7-15-10(12)2/h3-4,6,8-10,12,14H,5,7H2,1-2H3 |
| InChIKey | FLOHXEFYYLMWID-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |