C19H32N2 — CID 43079395
N-(1-pyridin-3-ylethyl)cyclododecanamine (PubChem CID 43079395) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is N-(1-pyridin-3-ylethyl)cyclododecanamine.
| Compound Name | N-(1-pyridin-3-ylethyl)cyclododecanamine |
|---|---|
| PubChem CID | 43079395 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N-(1-pyridin-3-ylethyl)cyclododecanamine |
| SMILES | CC(NC1CCCCCCCCCCC1)c1cccnc1 |
| InChI | InChI=1S/C19H32N2/c1-17(18-12-11-15-20-16-18)21-19-13-9-7-5-3-2-4-6-8-10-14-19/h11-12,15-17,19,21H,2-10,13-14H2,1H3 |
| InChIKey | TZHRBCFVZZIFHH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |