C12H19N3 — CID 81406551
3-N-[(1S)-1-pyridin-3-ylethyl]cyclopentane-1,3-diamine (PubChem CID 81406551) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 3-N-[(1S)-1-pyridin-3-ylethyl]cyclopentane-1,3-diamine.
| Compound Name | 3-N-[(1S)-1-pyridin-3-ylethyl]cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 81406551 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-N-[(1S)-1-pyridin-3-ylethyl]cyclopentane-1,3-diamine |
| SMILES | C[C@H](NC1CCC(N)C1)c1cccnc1 |
| InChI | InChI=1S/C12H19N3/c1-9(10-3-2-6-14-8-10)15-12-5-4-11(13)7-12/h2-3,6,8-9,11-12,15H,4-5,7,13H2,1H3/t9-,11?,12?/m0/s1 |
| InChIKey | BILQEUCTLHOGDN-GCVQQVDUSA-N |
| XLogP | 1.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |