C16H26N2 — CID 28655963
4-propyl-N-[(1S)-1-pyridin-3-ylethyl]cyclohexan-1-amine (PubChem CID 28655963) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 4-propyl-N-[(1S)-1-pyridin-3-ylethyl]cyclohexan-1-amine.
| Compound Name | 4-propyl-N-[(1S)-1-pyridin-3-ylethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 28655963 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4-propyl-N-[(1S)-1-pyridin-3-ylethyl]cyclohexan-1-amine |
| SMILES | CCCC1CCC(N[C@@H](C)c2cccnc2)CC1 |
| InChI | InChI=1S/C16H26N2/c1-3-5-14-7-9-16(10-8-14)18-13(2)15-6-4-11-17-12-15/h4,6,11-14,16,18H,3,5,7-10H2,1-2H3/t13-,14?,16?/m0/s1 |
| InChIKey | XCHNLHBXHUCBJR-HLIUYOAVSA-N |
| XLogP | 4.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |