C12H18N2O2S — CID 81406804
1,1-dioxo-N-[(1S)-1-pyridin-3-ylethyl]thian-4-amine (PubChem CID 81406804) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1,1-dioxo-N-[(1S)-1-pyridin-3-ylethyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[(1S)-1-pyridin-3-ylethyl]thian-4-amine |
|---|---|
| PubChem CID | 81406804 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1,1-dioxo-N-[(1S)-1-pyridin-3-ylethyl]thian-4-amine |
| SMILES | C[C@H](NC1CCS(=O)(=O)CC1)c1cccnc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-10(11-3-2-6-13-9-11)14-12-4-7-17(15,16)8-5-12/h2-3,6,9-10,12,14H,4-5,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | RKOPEEHPGKTBHW-JTQLQIEISA-N |
| XLogP | 1.31 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |