C12H16ClNO3S — CID 60666002
4-[1-(4-chlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol (PubChem CID 60666002) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[1-(4-chlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60666002 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-[1-(4-chlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(NC1CS(=O)(=O)CC1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO3S/c1-8(9-2-4-10(13)5-3-9)14-11-6-18(16,17)7-12(11)15/h2-5,8,11-12,14-15H,6-7H2,1H3 |
| InChIKey | QDIPHLHVCPYFNS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |