C12H15Cl2NO3S — CID 60665717
4-[1-(2,4-dichlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol (PubChem CID 60665717) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is 4-[1-(2,4-dichlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[1-(2,4-dichlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60665717 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-[1-(2,4-dichlorophenyl)ethylamino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(NC1CS(=O)(=O)CC1O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-7(9-3-2-8(13)4-10(9)14)15-11-5-19(17,18)6-12(11)16/h2-4,7,11-12,15-16H,5-6H2,1H3 |
| InChIKey | XMTUQOXAISHZAH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |