C15H17Cl2N — CID 43223321
N-[1-(2,4-dichlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 43223321) has the molecular formula C15H17Cl2N and a molecular weight of 282.21 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 43223321 |
| Molecular Formula | C15H17Cl2N |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CC(NC1CC2CC=CC21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H17Cl2N/c1-9(12-6-5-11(16)8-14(12)17)18-15-7-10-3-2-4-13(10)15/h2,4-6,8-10,13,15,18H,3,7H2,1H3 |
| InChIKey | HCPRMGXTGGBRHH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|