C15H18FN — CID 81348288
N-[(1R)-1-(4-fluorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 81348288) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 81348288 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | C[C@@H](NC1CC2CC=CC21)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FN/c1-10(11-5-7-13(16)8-6-11)17-15-9-12-3-2-4-14(12)15/h2,4-8,10,12,14-15,17H,3,9H2,1H3/t10-,12?,14?,15?/m1/s1 |
| InChIKey | IJSUOXDFDCWHDL-GBUIOSHMSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|