C13H17NO — CID 81402601
N-[(1S)-1-(furan-2-yl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 81402601) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 81402601 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | C[C@H](NC1CC2CC=CC21)c1ccco1 |
| InChI | InChI=1S/C13H17NO/c1-9(13-6-3-7-15-13)14-12-8-10-4-2-5-11(10)12/h2-3,5-7,9-12,14H,4,8H2,1H3/t9-,10?,11?,12?/m0/s1 |
| InChIKey | ZDWYCTNMMPTGJU-ZLMIFYAYSA-N |
| XLogP | 2.89 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|