C10H16N2O2 — CID 131175689
(3R,4R)-4-[1-(furan-2-yl)ethylamino]pyrrolidin-3-ol (PubChem CID 131175689) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3R,4R)-4-[1-(furan-2-yl)ethylamino]pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[1-(furan-2-yl)ethylamino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 131175689 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (3R,4R)-4-[1-(furan-2-yl)ethylamino]pyrrolidin-3-ol |
| SMILES | CC(N[C@@H]1CNC[C@H]1O)c1ccco1 |
| InChI | InChI=1S/C10H16N2O2/c1-7(10-3-2-4-14-10)12-8-5-11-6-9(8)13/h2-4,7-9,11-13H,5-6H2,1H3/t7?,8-,9-/m1/s1 |
| InChIKey | OLWWKVBUEJKHLX-CFCGPWAMSA-N |
| XLogP | 0.26 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |