C12H20N2O — CID 81403374
2-(aminomethyl)-N-[(1S)-1-(furan-2-yl)ethyl]cyclopentan-1-amine (PubChem CID 81403374) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(1S)-1-(furan-2-yl)ethyl]cyclopentan-1-amine.
| Compound Name | 2-(aminomethyl)-N-[(1S)-1-(furan-2-yl)ethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 81403374 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(aminomethyl)-N-[(1S)-1-(furan-2-yl)ethyl]cyclopentan-1-amine |
| SMILES | C[C@H](NC1CCCC1CN)c1ccco1 |
| InChI | InChI=1S/C12H20N2O/c1-9(12-6-3-7-15-12)14-11-5-2-4-10(11)8-13/h3,6-7,9-11,14H,2,4-5,8,13H2,1H3/t9-,10?,11?/m0/s1 |
| InChIKey | NTUXZPQNSBPZOO-WHXUTIOJSA-N |
| XLogP | 2.06 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |