C16H27N — CID 81388211
N-[(1S)-1-cycloheptylethyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 81388211) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is N-[(1S)-1-cycloheptylethyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[(1S)-1-cycloheptylethyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 81388211 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | N-[(1S)-1-cycloheptylethyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | C[C@H](NC1CC2CC=CC21)C1CCCCCC1 |
| InChI | InChI=1S/C16H27N/c1-12(13-7-4-2-3-5-8-13)17-16-11-14-9-6-10-15(14)16/h6,10,12-17H,2-5,7-9,11H2,1H3/t12-,14?,15?,16?/m0/s1 |
| InChIKey | CPEVGOGMCHKBDE-SFLNLBOUSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|