C15H18ClN — CID 81371686
N-[(1S)-1-(3-chlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 81371686) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 81371686 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | C[C@H](NC1CC2CC=CC21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H18ClN/c1-10(11-4-2-6-13(16)8-11)17-15-9-12-5-3-7-14(12)15/h2-4,6-8,10,12,14-15,17H,5,9H2,1H3/t10-,12?,14?,15?/m0/s1 |
| InChIKey | RFJBWBLMXFGMJC-SBRZMFFBSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|