C13H17Cl2NO2S — CID 54915725
1-(2,4-dichlorophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine (PubChem CID 54915725) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 54915725 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]ethanamine |
| SMILES | CC(NCC1CCS(=O)(=O)C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-9(12-3-2-11(14)6-13(12)15)16-7-10-4-5-19(17,18)8-10/h2-3,6,9-10,16H,4-5,7-8H2,1H3 |
| InChIKey | OIJDJHWSDJHKLD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |