C16H24Cl2IN3O2S — CID 119139892
2-[(2,4-dichlorophenyl)methyl]-1-[(1,1-dioxothiolan-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide (PubChem CID 119139892) has the molecular formula C16H24Cl2IN3O2S and a molecular weight of 520.26 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-[(1,1-dioxothiolan-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-[(1,1-dioxothiolan-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119139892 |
| Molecular Formula | C16H24Cl2IN3O2S |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-[(1,1-dioxothiolan-3-yl)methyl]-3-propan-2-ylguanidine;hydroiodide |
| SMILES | CC(C)N/C(=N\Cc1ccc(Cl)cc1Cl)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H23Cl2N3O2S.HI/c1-11(2)21-16(19-8-12-5-6-24(22,23)10-12)20-9-13-3-4-14(17)7-15(13)18;/h3-4,7,11-12H,5-6,8-10H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | LVEYBEKJDRVHLA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|