C17H27Cl2IN4O2S — CID 111198033
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111198033) has the molecular formula C17H27Cl2IN4O2S and a molecular weight of 549.31 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111198033 |
| Molecular Formula | C17H27Cl2IN4O2S |
| Molecular Weight | 549.31 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC1CCN(S(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C17H26Cl2N4O2S.HI/c1-3-20-17(22-12-14-4-5-15(18)10-16(14)19)21-11-13-6-8-23(9-7-13)26(2,24)25;/h4-5,10,13H,3,6-9,11-12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | QCGIAZMCAKVOFY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|