C15H24Cl2IN3O2S — CID 111967078
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide (PubChem CID 111967078) has the molecular formula C15H24Cl2IN3O2S and a molecular weight of 508.25 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111967078 |
| Molecular Formula | C15H24Cl2IN3O2S |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-methyl-2-methylsulfonylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC(C)(C)S(C)(=O)=O.I |
| InChI | InChI=1S/C15H23Cl2N3O2S.HI/c1-5-18-14(20-10-15(2,3)23(4,21)22)19-9-11-6-7-12(16)8-13(11)17;/h6-8H,5,9-10H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | DYAMQLXUWXPKAK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|