C15H21Cl2N3O — CID 111965551
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[[1-(hydroxymethyl)cyclopropyl]methyl]guanidine (PubChem CID 111965551) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[[1-(hydroxymethyl)cyclopropyl]methyl]guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[[1-(hydroxymethyl)cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 111965551 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[[1-(hydroxymethyl)cyclopropyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC1(CO)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O/c1-2-18-14(20-9-15(10-21)5-6-15)19-8-11-3-4-12(16)7-13(11)17/h3-4,7,21H,2,5-6,8-10H2,1H3,(H2,18,19,20) |
| InChIKey | IIQKGIBFQICPPR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|