C15H21Cl2N3OS — CID 111908241
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(3-hydroxythiolan-3-yl)methyl]guanidine (PubChem CID 111908241) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(3-hydroxythiolan-3-yl)methyl]guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(3-hydroxythiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111908241 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[(3-hydroxythiolan-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC1(O)CCSC1 |
| InChI | InChI=1S/C15H21Cl2N3OS/c1-2-18-14(20-9-15(21)5-6-22-10-15)19-8-11-3-4-12(16)7-13(11)17/h3-4,7,21H,2,5-6,8-10H2,1H3,(H2,18,19,20) |
| InChIKey | LTSVFTVGDVOIPE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|