C17H25ClF2IN3O2 — CID 111989068
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111989068) has the molecular formula C17H25ClF2IN3O2 and a molecular weight of 503.76 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111989068 |
| Molecular Formula | C17H25ClF2IN3O2 |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-[(1-hydroxycyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)ccc1OC(F)F)NCC1(O)CCCC1.I |
| InChI | InChI=1S/C17H24ClF2N3O2.HI/c1-2-21-16(23-11-17(24)7-3-4-8-17)22-10-12-9-13(18)5-6-14(12)25-15(19)20;/h5-6,9,15,24H,2-4,7-8,10-11H2,1H3,(H2,21,22,23);1H |
| InChIKey | DPJZMCRPPDHMOR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|