C18H25ClF2N4O2 — CID 111708867
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine (PubChem CID 111708867) has the molecular formula C18H25ClF2N4O2 and a molecular weight of 402.87 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111708867 |
| Molecular Formula | C18H25ClF2N4O2 |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(Cl)ccc1OC(F)F)NCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H25ClF2N4O2/c1-2-22-18(24-12-16(26)25-8-4-3-5-9-25)23-11-13-10-14(19)6-7-15(13)27-17(20)21/h6-7,10,17H,2-5,8-9,11-12H2,1H3,(H2,22,23,24) |
| InChIKey | MKSQBZWVMYDSKD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|