C16H22Cl2N4O — CID 111198270
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111198270) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111198270 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C16H22Cl2N4O/c1-2-19-16(21-11-15(23)22-7-3-4-8-22)20-10-12-5-6-13(17)9-14(12)18/h5-6,9H,2-4,7-8,10-11H2,1H3,(H2,19,20,21) |
| InChIKey | LDTXJHMSLQNRTN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|