C18H28Cl2N4O — CID 111782195
2-[(2,4-dichlorophenyl)methyl]-1-[[4-(dimethylamino)oxan-4-yl]methyl]-3-ethylguanidine (PubChem CID 111782195) has the molecular formula C18H28Cl2N4O and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-[[4-(dimethylamino)oxan-4-yl]methyl]-3-ethylguanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-[[4-(dimethylamino)oxan-4-yl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111782195 |
| Molecular Formula | C18H28Cl2N4O |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-[[4-(dimethylamino)oxan-4-yl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC1(N(C)C)CCOCC1 |
| InChI | InChI=1S/C18H28Cl2N4O/c1-4-21-17(22-12-14-5-6-15(19)11-16(14)20)23-13-18(24(2)3)7-9-25-10-8-18/h5-6,11H,4,7-10,12-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | XFVLAJXVJCMKSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|