C21H26Cl2N4O — CID 110967980
1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 110967980) has the molecular formula C21H26Cl2N4O and a molecular weight of 421.37 g/mol. Its IUPAC name is 1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110967980 |
| Molecular Formula | C21H26Cl2N4O |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-3-ethyl-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCC1(c2ccc(Cl)cc2Cl)CCOCC1 |
| InChI | InChI=1S/C21H26Cl2N4O/c1-2-24-20(26-14-17-5-3-4-10-25-17)27-15-21(8-11-28-12-9-21)18-7-6-16(22)13-19(18)23/h3-7,10,13H,2,8-9,11-12,14-15H2,1H3,(H2,24,26,27) |
| InChIKey | QGBLWLYEOUGDII-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|