C21H32Cl2N4O2 — CID 111188305
2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111188305) has the molecular formula C21H32Cl2N4O2 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111188305 |
| Molecular Formula | C21H32Cl2N4O2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)NCCN1CCOCC1 |
| InChI | InChI=1S/C21H32Cl2N4O2/c1-2-24-20(25-7-8-27-9-13-29-14-10-27)26-16-21(5-11-28-12-6-21)18-4-3-17(22)15-19(18)23/h3-4,15H,2,5-14,16H2,1H3,(H2,24,25,26) |
| InChIKey | UDKCKDHQOVKJJX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|