C21H30Cl2N4O2 — CID 110962475
4-acetyl-N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110962475) has the molecular formula C21H30Cl2N4O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 4-acetyl-N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962475 |
| Molecular Formula | C21H30Cl2N4O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-acetyl-N'-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccc(Cl)cc2Cl)CCOCC1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C21H30Cl2N4O2/c1-3-24-20(27-10-8-26(9-11-27)16(2)28)25-15-21(6-12-29-13-7-21)18-5-4-17(22)14-19(18)23/h4-5,14H,3,6-13,15H2,1-2H3,(H,24,25) |
| InChIKey | QDGGSPILYADRHP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|