C18H27Cl2IN4O2 — CID 110962714
4-acetyl-N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110962714) has the molecular formula C18H27Cl2IN4O2 and a molecular weight of 529.25 g/mol. Its IUPAC name is 4-acetyl-N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110962714 |
| Molecular Formula | C18H27Cl2IN4O2 |
| Molecular Weight | 529.25 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 4-acetyl-N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOc1ccc(Cl)cc1Cl)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C18H26Cl2N4O2.HI/c1-3-21-18(24-10-8-23(9-11-24)14(2)25)22-7-4-12-26-17-6-5-15(19)13-16(17)20;/h5-6,13H,3-4,7-12H2,1-2H3,(H,21,22);1H |
| InChIKey | AQYBVTDAENFIPR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|