C19H27Cl2N3O3 — CID 111253503
methyl 1-[N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111253503) has the molecular formula C19H27Cl2N3O3 and a molecular weight of 416.35 g/mol. Its IUPAC name is methyl 1-[N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111253503 |
| Molecular Formula | C19H27Cl2N3O3 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | methyl 1-[N'-[3-(2,4-dichlorophenoxy)propyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCCOc1ccc(Cl)cc1Cl)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C19H27Cl2N3O3/c1-3-22-19(24-10-7-14(8-11-24)18(25)26-2)23-9-4-12-27-17-6-5-15(20)13-16(17)21/h5-6,13-14H,3-4,7-12H2,1-2H3,(H,22,23) |
| InChIKey | HGGZVLKCBBLZQD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|