C21H30Cl2IN3O3 — CID 111254642
methyl 1-[N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111254642) has the molecular formula C21H30Cl2IN3O3 and a molecular weight of 570.30 g/mol. Its IUPAC name is methyl 1-[N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111254642 |
| Molecular Formula | C21H30Cl2IN3O3 |
| Molecular Weight | 570.30 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | methyl 1-[N-[[4-(2,4-dichlorophenyl)oxan-4-yl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccc(Cl)cc2Cl)CCOCC1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C21H29Cl2N3O3.HI/c1-24-20(26-9-5-15(6-10-26)19(27)28-2)25-14-21(7-11-29-12-8-21)17-4-3-16(22)13-18(17)23;/h3-4,13,15H,5-12,14H2,1-2H3,(H,24,25);1H |
| InChIKey | GCEGQMLXSHMVFH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|