C22H34IN3O3 — CID 111253426
methyl 1-[N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111253426) has the molecular formula C22H34IN3O3 and a molecular weight of 515.44 g/mol. Its IUPAC name is methyl 1-[N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111253426 |
| Molecular Formula | C22H34IN3O3 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | methyl 1-[N-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2OC)CCCC1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C22H33N3O3.HI/c1-23-21(25-14-10-17(11-15-25)20(26)28-3)24-16-22(12-6-7-13-22)18-8-4-5-9-19(18)27-2;/h4-5,8-9,17H,6-7,10-16H2,1-3H3,(H,23,24);1H |
| InChIKey | LDBKJUTWKXXBDX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|