C23H30IN3O — CID 111724296
N-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111724296) has the molecular formula C23H30IN3O and a molecular weight of 491.42 g/mol. Its IUPAC name is N-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111724296 |
| Molecular Formula | C23H30IN3O |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N-[[1-(2-methoxyphenyl)cyclopropyl]methyl]-N'-methyl-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2OC)CC1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C23H29N3O.HI/c1-24-22(26-15-12-19(16-26)18-8-4-3-5-9-18)25-17-23(13-14-23)20-10-6-7-11-21(20)27-2;/h3-11,19H,12-17H2,1-2H3,(H,24,25);1H |
| InChIKey | XXILXSGABGBACL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|