C22H32FN3O2 — CID 111252949
methyl 1-[N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252949) has the molecular formula C22H32FN3O2 and a molecular weight of 389.52 g/mol. Its IUPAC name is methyl 1-[N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252949 |
| Molecular Formula | C22H32FN3O2 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | methyl 1-[N-[[1-(3-fluorophenyl)cyclohexyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C/N=C(/NCC1(c2cccc(F)c2)CCCCC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C22H32FN3O2/c1-24-21(26-13-9-17(10-14-26)20(27)28-2)25-16-22(11-4-3-5-12-22)18-7-6-8-19(23)15-18/h6-8,15,17H,3-5,9-14,16H2,1-2H3,(H,24,25) |
| InChIKey | SFMDVMZBSYLTFL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|