C23H35F3IN3O2 — CID 111746502
3-(2-methoxyethoxymethyl)-N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746502) has the molecular formula C23H35F3IN3O2 and a molecular weight of 569.45 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746502 |
| Molecular Formula | C23H35F3IN3O2 |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC1(c2cccc(C(F)(F)F)c2)CCCC1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C23H34F3N3O2.HI/c1-27-21(29-11-8-18(15-29)16-31-13-12-30-2)28-17-22(9-3-4-10-22)19-6-5-7-20(14-19)23(24,25)26;/h5-7,14,18H,3-4,8-13,15-17H2,1-2H3,(H,27,28);1H |
| InChIKey | VSOTXGCLRRQJJU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|