C22H35N3O — CID 111737711
3-(methoxymethyl)-N'-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111737711) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111737711 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-[[1-(2-methylphenyl)cyclohexyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccccc2C)CCCCC1)N1CCC(COC)C1 |
| InChI | InChI=1S/C22H35N3O/c1-18-9-5-6-10-20(18)22(12-7-4-8-13-22)17-24-21(23-2)25-14-11-19(15-25)16-26-3/h5-6,9-10,19H,4,7-8,11-17H2,1-3H3,(H,23,24) |
| InChIKey | ROOSORHFYHSTPL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|